6-chloro-2-(6-methylpyridin-2-yl)-1H-benzimidazole structure
|
Common Name | 6-chloro-2-(6-methylpyridin-2-yl)-1H-benzimidazole | ||
|---|---|---|---|---|
| CAS Number | 67273-53-4 | Molecular Weight | 243.69200 | |
| Density | 1.34g/cm3 | Boiling Point | 461.2ºC at 760 mmHg | |
| Molecular Formula | C13H10ClN3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 265.2ºC | |
| Name | 6-chloro-2-(6-methylpyridin-2-yl)-1H-benzimidazole |
|---|
| Density | 1.34g/cm3 |
|---|---|
| Boiling Point | 461.2ºC at 760 mmHg |
| Molecular Formula | C13H10ClN3 |
| Molecular Weight | 243.69200 |
| Flash Point | 265.2ºC |
| Exact Mass | 243.05600 |
| PSA | 41.57000 |
| LogP | 3.58670 |
| Index of Refraction | 1.683 |
| InChIKey | DIFHNJNBZCBMEY-UHFFFAOYSA-N |
| SMILES | Cc1cccc(-c2nc3ccc(Cl)cc3[nH]2)n1 |
|
~71%
6-chloro-2-(6-m... CAS#:67273-53-4 |
| Literature: Tsukamoto; Yoshino; Kohno; Ohtaka; Kagaya; Ito Journal of Medicinal Chemistry, 1980 , vol. 23, # 7 p. 734 - 738 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |