pentan-2-yl-diphenyl-sulfanylidene-λ5-phosphane structure
|
Common Name | pentan-2-yl-diphenyl-sulfanylidene-λ5-phosphane | ||
|---|---|---|---|---|
| CAS Number | 66004-03-3 | Molecular Weight | 288.38700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H21PS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | pentan-2-yl-diphenyl-sulfanylidene-λ5-phosphane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C17H21PS |
|---|---|
| Molecular Weight | 288.38700 |
| Exact Mass | 288.11000 |
| PSA | 41.90000 |
| LogP | 4.95610 |
| InChIKey | XHGLBOBCTAGVOM-UHFFFAOYSA-N |
| SMILES | CCCC(C)P(=S)(c1ccccc1)c1ccccc1 |
|
~92%
pentan-2-yl-dip... CAS#:66004-03-3 |
| Literature: Yoshifuji, Masaaki; Ishizuka, Tadao; Choi, Yoon Jung; Inamoto, Naoki Tetrahedron Letters, 1984 , vol. 25, # 5 p. 553 - 556 |
|
~62%
pentan-2-yl-dip... CAS#:66004-03-3
Detail
|
| Literature: Yoshifuji, Masaaki; Ishizuka, Tadao; Choi, Yoon Jung; Inamoto, Naoki Tetrahedron Letters, 1984 , vol. 25, # 5 p. 553 - 556 |
|
~%
pentan-2-yl-dip... CAS#:66004-03-3 |
| Literature: Goda,K. et al. Bulletin of the Chemical Society of Japan, 1978 , vol. 51, p. 260 - 264 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 2-Pentyl-diphenyl-phosphinsulfid |
| 1-methylbutyldiphenylphosphine sulfide |
| Phosphine sulfide,(1-methylbutyl)diphenyl |
| 1-Methylbutyl-diphenylphosphinsulfid |