2-[(2-chloro-6-fluorophenyl)methylsulfanyl]-3-(4-methoxyphenyl)-5H-pyrimido[5,4-b]indol-4-one
Modify Date: 2025-09-25 21:07:43
![2-[(2-chloro-6-fluorophenyl)methylsulfanyl]-3-(4-methoxyphenyl)-5H-pyrimido[5,4-b]indol-4-one Structure](https://image.chemsrc.com/caspic/287/6238-07-9.png)
2-[(2-chloro-6-fluorophenyl)methylsulfanyl]-3-(4-methoxyphenyl)-5H-pyrimido[5,4-b]indol-4-one structure
|
Common Name | 2-[(2-chloro-6-fluorophenyl)methylsulfanyl]-3-(4-methoxyphenyl)-5H-pyrimido[5,4-b]indol-4-one | ||
|---|---|---|---|---|
| CAS Number | 6238-07-9 | Molecular Weight | 465.92700 | |
| Density | 1.42g/cm3 | Boiling Point | 679.9ºC at 760 mmHg | |
| Molecular Formula | C24H17ClFN3O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 365ºC | |
| Name | 2-[(2-chloro-6-fluorophenyl)methylsulfanyl]-3-(4-methoxyphenyl)-5H-pyrimido[5,4-b]indol-4-one |
|---|
| Density | 1.42g/cm3 |
|---|---|
| Boiling Point | 679.9ºC at 760 mmHg |
| Molecular Formula | C24H17ClFN3O2S |
| Molecular Weight | 465.92700 |
| Flash Point | 365ºC |
| Exact Mass | 465.07100 |
| PSA | 85.21000 |
| LogP | 5.96040 |
| Index of Refraction | 1.691 |
| InChIKey | UQMAGOPOUCOUFY-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)N2C(=O)C3=C(C4=CC=CC=C4N3)N=C2SCC5=C(C=CC=C5Cl)F |
|
~%
2-[(2-chloro-6-... CAS#:6238-07-9 |
| Literature: Anderson,M.; Johnson,A.W. Journal of the Chemical Society [Section] C: Organic, 1966 , p. 1075 - 1078 |
