methyl 3-[(2,4-dimethylphenyl)carbamoyl]pyrazole-1-carboxylate structure
|
Common Name | methyl 3-[(2,4-dimethylphenyl)carbamoyl]pyrazole-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 6125-75-3 | Molecular Weight | 273.28700 | |
| Density | 1.24g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C14H15N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methyl 3-[(2,4-dimethylphenyl)carbamoyl]pyrazole-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.24g/cm3 |
|---|---|
| Molecular Formula | C14H15N3O3 |
| Molecular Weight | 273.28700 |
| Exact Mass | 273.11100 |
| PSA | 73.22000 |
| LogP | 2.43970 |
| Index of Refraction | 1.594 |
| InChIKey | ZOEUMOOCBWYIBQ-UHFFFAOYSA-N |
| SMILES | COC(=O)n1ccc(C(=O)Nc2ccc(C)cc2C)n1 |
|
~84%
methyl 3-[(2,4-... CAS#:6125-75-3 |
| Literature: Pastushenko, E. V.; Safiulova, G. I.; Kruglov, D. E. Journal of Organic Chemistry USSR (English Translation), 1991 , vol. 27, # 11.2 p. 2143 - 2148 Zhurnal Organicheskoi Khimii, 1991 , vol. 27, # 11 p. 2412 - 2418 |
| sec-butylidene-cyclohexyl-amine |
| N-cyclohexylbutylidene-2-imine |
| N-2-butylidene cyclohexylamine |