1-methyl-10H-phenothiazine 5,5-dioxide structure
|
Common Name | 1-methyl-10H-phenothiazine 5,5-dioxide | ||
|---|---|---|---|---|
| CAS Number | 61174-76-3 | Molecular Weight | 245.29700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H11NO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-methyl-10H-phenothiazine 5,5-dioxide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H11NO2S |
|---|---|
| Molecular Weight | 245.29700 |
| Exact Mass | 245.05100 |
| PSA | 54.55000 |
| LogP | 4.10360 |
| InChIKey | LHELWMVVWNXDCK-UHFFFAOYSA-N |
| SMILES | Cc1cccc2c1Nc1ccccc1S2(=O)=O |
|
~%
1-methyl-10H-ph... CAS#:61174-76-3 |
| Literature: Cadogan,J.I.G. et al. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1976 , p. 1749 - 1757 |
| 10H-Phenothiazine,1-methyl-,5,5-dioxide |
| 1-Methylphenothiazin-5,5-dioxid |