1-chloro-10H-phenothiazine 5,5-dioxide structure
|
Common Name | 1-chloro-10H-phenothiazine 5,5-dioxide | ||
|---|---|---|---|---|
| CAS Number | 61174-84-3 | Molecular Weight | 265.71500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H8ClNO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-chloro-10H-phenothiazine 5,5-dioxide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H8ClNO2S |
|---|---|
| Molecular Weight | 265.71500 |
| Exact Mass | 264.99600 |
| PSA | 54.55000 |
| LogP | 4.44860 |
| InChIKey | ISEXLFKPJQQKTA-UHFFFAOYSA-N |
| SMILES | O=S1(=O)c2ccccc2Nc2c(Cl)cccc21 |
|
~%
1-chloro-10H-ph... CAS#:61174-84-3 |
| Literature: Cadogan,J.I.G. et al. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1976 , p. 1749 - 1757 |
| 10H-Phenothiazine,1-chloro-,5,5-dioxide |
| 1-Chlorphenothiazin-5,5-dioxid |