1-fluoro-4-(4-fluorophenyl)sulfinylsulfanylbenzene structure
|
Common Name | 1-fluoro-4-(4-fluorophenyl)sulfinylsulfanylbenzene | ||
|---|---|---|---|---|
| CAS Number | 61169-14-0 | Molecular Weight | 270.31800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H8F2OS2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-fluoro-4-(4-fluorophenyl)sulfinylsulfanylbenzene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H8F2OS2 |
|---|---|
| Molecular Weight | 270.31800 |
| Exact Mass | 269.99800 |
| PSA | 61.58000 |
| LogP | 4.64540 |
| InChIKey | GIFYQTXUIUTHCQ-UHFFFAOYSA-N |
| SMILES | O=S(Sc1ccc(F)cc1)c1ccc(F)cc1 |
|
~%
1-fluoro-4-(4-f... CAS#:61169-14-0 |
| Literature: Chau,M.M.; Kice,J.L. Journal of the American Chemical Society, 1976 , vol. 98, # 24 p. 7711 - 7716 |
| S-p-fluorophenyl p-fluorobenzenethiosulfinate |
| p-Fluorophenyl-p-fluorobenzolthiolsulfinat |