5-[(3-bromo-4-ethoxyphenyl)methylidene]-1-(4-chlorophenyl)-1,3-diazinane-2,4,6-trione structure
|
Common Name | 5-[(3-bromo-4-ethoxyphenyl)methylidene]-1-(4-chlorophenyl)-1,3-diazinane-2,4,6-trione | ||
|---|---|---|---|---|
| CAS Number | 6068-98-0 | Molecular Weight | 449.68200 | |
| Density | 1.585g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C19H14BrClN2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-[(3-bromo-4-ethoxyphenyl)methylidene]-1-(4-chlorophenyl)-1,3-diazinane-2,4,6-trione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.585g/cm3 |
|---|---|
| Molecular Formula | C19H14BrClN2O4 |
| Molecular Weight | 449.68200 |
| Exact Mass | 447.98300 |
| PSA | 79.20000 |
| LogP | 4.50850 |
| Index of Refraction | 1.66 |
| InChIKey | KGRAYCXMFLDDKM-NTEUORMPSA-N |
| SMILES | CCOc1ccc(C=C2C(=O)NC(=O)N(c3ccc(Cl)cc3)C2=O)cc1Br |
|
~%
5-[(3-bromo-4-e... CAS#:6068-98-0 |
| Literature: Evans Chemistry and Industry (London, United Kingdom), 1958 , p. 915 |
| 1,1'-Aethylendihydrazin |
| ethylenedihydrazine |
| (5E)-5-[(3-bromo-4-ethoxy-phenyl)methylidene]-1-(4-chlorophenyl)-1,3-diazinane-2,4,6-trione |
| N,N''-Aethandiyldi-hydrazin |
| 1,2-Dihydrazino-aethan |
| (5Z)-5-(3-bromo-4-ethoxybenzylidene)-1-(4-chlorophenyl)pyrimidine-2,4,6(1H,3H,5H)-trione |
| ethylene bis(hydrazine) |
| 2-Hydrazinoethyl-hydrazin |
| N,N''-ethanediyldi-hydrazine |
| (5E)-5-(3-bromo-4-ethoxybenzylidene)-1-(4-chlorophenyl)pyrimidine-2,4,6(1H,3H,5H)-trione |