ethyl 2-(2-hydroxy-1,3-dihydroinden-2-yl)acetate structure
|
Common Name | ethyl 2-(2-hydroxy-1,3-dihydroinden-2-yl)acetate | ||
|---|---|---|---|---|
| CAS Number | 57932-04-4 | Molecular Weight | 220.26400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H16O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl 2-(2-hydroxy-1,3-dihydroinden-2-yl)acetate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H16O3 |
|---|---|
| Molecular Weight | 220.26400 |
| Exact Mass | 220.11000 |
| PSA | 46.53000 |
| LogP | 1.46950 |
| InChIKey | WRTWQOZLEIKMES-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC1(O)Cc2ccccc2C1 |
|
~51%
ethyl 2-(2-hydr... CAS#:57932-04-4 |
| Literature: ALTANA Pharma AG Patent: WO2006/134111 A1, 2006 ; Location in patent: Page/Page column 36 ; |
|
~50%
ethyl 2-(2-hydr... CAS#:57932-04-4 |
| Literature: ALTANA Pharma AG Patent: WO2006/134112 A1, 2006 ; Location in patent: Page/Page column 23-24 ; |
|
~%
ethyl 2-(2-hydr... CAS#:57932-04-4 |
| Literature: Ahmed,H.; Campbell,N. Journal of the Chemical Society, 1960 , p. 4115 - 4120 |
| 1H-Indene-2-acetic acid,2,3-dihydro-2-hydroxy-,ethyl ester |
| 2-hydroxyindane-2-acetic acid ethyl ester |
| Aethyl-2-hydroxyindan-2-acetat |