1-[2-chloro-1-(4-ethoxyphenyl)propyl]-4-ethoxybenzene structure
|
Common Name | 1-[2-chloro-1-(4-ethoxyphenyl)propyl]-4-ethoxybenzene | ||
|---|---|---|---|---|
| CAS Number | 56265-22-6 | Molecular Weight | 318.838 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 434.5±45.0 °C at 760 mmHg | |
| Molecular Formula | C19H23ClO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 137.4±23.9 °C | |
| Name | 1-[2-chloro-1-(4-ethoxyphenyl)propyl]-4-ethoxybenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 434.5±45.0 °C at 760 mmHg |
| Molecular Formula | C19H23ClO2 |
| Molecular Weight | 318.838 |
| Flash Point | 137.4±23.9 °C |
| Exact Mass | 318.138672 |
| PSA | 18.46000 |
| LogP | 5.44 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.537 |
| InChIKey | XALCLEMPULMGDC-UHFFFAOYSA-N |
| SMILES | CCOc1ccc(C(c2ccc(OCC)cc2)C(C)Cl)cc1 |
| HS Code | 2909309090 |
|---|
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 1,1'-(2-Chloropropane-1,1-diyl)bis(4-ethoxybenzene) |
| Benzene, 1,1'-(2-chloropropylidene)bis[4-ethoxy- |
| 1,1'-(2-Chloro-1,1-propanediyl)bis(4-ethoxybenzene) |