N-cyclohexyl-4,6-dimethoxy-1,3,5-triazin-2-amine structure
|
Common Name | N-cyclohexyl-4,6-dimethoxy-1,3,5-triazin-2-amine | ||
|---|---|---|---|---|
| CAS Number | 55338-67-5 | Molecular Weight | 238.28600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H18N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-cyclohexyl-4,6-dimethoxy-1,3,5-triazin-2-amine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H18N4O2 |
|---|---|
| Molecular Weight | 238.28600 |
| Exact Mass | 238.14300 |
| PSA | 72.39000 |
| LogP | 1.05530 |
| InChIKey | BQBJLTXZKQRIBT-UHFFFAOYSA-N |
| SMILES | COc1nc(NC2CCCCC2)nc(OC)n1 |
|
~%
N-cyclohexyl-4,... CAS#:55338-67-5 |
| Literature: Dudley et al. Journal of the American Chemical Society, 1951 , vol. 73, p. 2986,2989 |
|
~46%
N-cyclohexyl-4,... CAS#:55338-67-5 |
| Literature: Chapyshev, Sergei V. Mendeleev Communications, 2002 , vol. 12, # 6 p. 227 - 229 |
|
~%
N-cyclohexyl-4,... CAS#:55338-67-5 |
| Literature: Am.Cyanamid Co. Patent: US2508323 , 1946 ; |
| 2-Cyclohexyl-amino-4,6-dimethoxy-1,3,5-triazin |
| 1,3,5-Triazin-2-amine,N-cyclohexyl-4,6-dimethoxy |
| 2-Cyclohexylamino-4,6-dimethoxy-s-triazin |