decyl 4-methylbenzenesulfonate structure
|
Common Name | decyl 4-methylbenzenesulfonate | ||
|---|---|---|---|---|
| CAS Number | 5509-08-0 | Molecular Weight | 312.46700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H28O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | decyl 4-methylbenzenesulfonate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C17H28O3S |
|---|---|
| Molecular Weight | 312.46700 |
| Exact Mass | 312.17600 |
| PSA | 51.75000 |
| LogP | 5.92180 |
| InChIKey | FHATWFATOZTOKS-UHFFFAOYSA-N |
| SMILES | CCCCCCCCCCOS(=O)(=O)c1ccc(C)cc1 |
|
~99%
decyl 4-methylb... CAS#:5509-08-0 |
| Literature: Kabalka, George W.; Varma, Manju; Varma, Rajender S. Journal of Organic Chemistry, 1986 , vol. 51, # 12 p. 2386 - 2388 |
|
~64%
decyl 4-methylb... CAS#:5509-08-0 |
| Literature: Das, Biswanath; Reddy, Vtukuri Saidi Chemistry Letters, 2004 , vol. 33, # 11 p. 1428 - 1429 |
|
~67%
decyl 4-methylb... CAS#:5509-08-0 |
| Literature: Nitta, Yoshihiro; Arakawa, Yasushi; Ueyama, Naoto Chemical and Pharmaceutical Bulletin, 1986 , vol. 34, # 7 p. 2710 - 2718 |
| Precursor 4 | |
|---|---|
| DownStream 9 | |
| Benzenesulfonic acid,4-methyl-,decyl ester |
| 1-decyl tosylate |
| decyl p-toluenesulfonate |
| decyl tosylate |
| 4-methyl-benzenesulfonic acid,decyl ester |
| n-decyl tosylate |