2-trimethylsilyl-2-trimethylsilyloxypropanenitrile structure
|
Common Name | 2-trimethylsilyl-2-trimethylsilyloxypropanenitrile | ||
|---|---|---|---|---|
| CAS Number | 53173-08-3 | Molecular Weight | 215.44000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H21NOSi2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-trimethylsilyl-2-trimethylsilyloxypropanenitrile |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H21NOSi2 |
|---|---|
| Molecular Weight | 215.44000 |
| Exact Mass | 215.11600 |
| PSA | 33.02000 |
| LogP | 3.41748 |
| InChIKey | KZRPSLLRUDMFLC-UHFFFAOYSA-N |
| SMILES | CC(C#N)(O[Si](C)(C)C)[Si](C)(C)C |
|
~86%
2-trimethylsily... CAS#:53173-08-3 |
| Literature: Cunico; Kuan Tetrahedron Letters, 1990 , vol. 31, # 14 p. 1945 - 1948 |
|
~%
2-trimethylsily... CAS#:53173-08-3 |
| Literature: Wright,A.; West,R. Journal of the American Chemical Society, 1974 , vol. 96, # 10 p. 3214 - 3222 |
| 2-Trimethylsiloxy-2-trimethylsilylpropanenitrile |
| Propanenitrile,2-(trimethylsilyl)-2-[(trimethylsilyl)oxy] |
| 2-(Trimethylsilyl)-2-<(trimethylsilyl)oxy>2-Trimethylsiloxy-2-trimethylsilylpropionitril |