Tolylbarb structure
|
Common Name | Tolylbarb | ||
|---|---|---|---|---|
| CAS Number | 52584-39-1 | Molecular Weight | 246.262 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C13H14N2O3 | Melting Point | 177-178ºC(lit.) | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,3,7-trimethylpyrrolo[2,3-d]pyrimidine-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Melting Point | 177-178ºC(lit.) |
| Molecular Formula | C13H14N2O3 |
| Molecular Weight | 246.262 |
| Exact Mass | 246.100449 |
| PSA | 82.25000 |
| LogP | 2.13 |
| Index of Refraction | 1.539 |
| InChIKey | ZYJDWGKPBQDCBX-UHFFFAOYSA-N |
| SMILES | CCC1(c2ccc(C)cc2)C(=O)NC(=O)NC1=O |
| HS Code | 2933540000 |
|---|---|
| Summary | 2933540000 other derivatives of malonylurea (barbituric acid); salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:20.0% |
| Tolylbarb |
| 2,4,6(1H,3H,5H)-Pyrimidinetrione, 5-ethyl-5-(4-methylphenyl)- |
| 1,3,7-trimethyl-1H,2H,3H,4H,7H-pyrrolo[2,3-d]pyrimidine-2,4-dione |
| 5-Ethyl-5-(4-methylphenyl)-2,4,6(1H,3H,5H)-pyrimidinetrione |
| 5-Ethyl-5-(4-methylphenyl)pyrimidine-2,4,6(1H,3H,5H)-trione |
| EINECS 258-023-9 |
| 1,3,7-trimethyl-1h-pyrrolo[2,3-d]pyrimidine-2,4(3h,7h)-dione |
| 1H-Pyrrolo(2,3-d)pyrimidine-2,4(3H,7H)-dione,1,3,7-trimethyl |