1,3-bis(2,4-dichlorophenyl)thiourea structure
|
Common Name | 1,3-bis(2,4-dichlorophenyl)thiourea | ||
|---|---|---|---|---|
| CAS Number | 52477-05-1 | Molecular Weight | 366.09300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H8Cl4N2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,3-bis(2,4-dichlorophenyl)thiourea |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H8Cl4N2S |
|---|---|
| Molecular Weight | 366.09300 |
| Exact Mass | 363.91600 |
| PSA | 63.19000 |
| LogP | 6.40260 |
| InChIKey | LPHHXYWWIUGMIV-UHFFFAOYSA-N |
| SMILES | S=C(Nc1ccc(Cl)cc1Cl)Nc1ccc(Cl)cc1Cl |
|
~%
1,3-bis(2,4-dic... CAS#:52477-05-1 |
| Literature: Raiford; McNulty Journal of the American Chemical Society, 1934 , vol. 56, p. 680 |
|
~%
1,3-bis(2,4-dic... CAS#:52477-05-1 |
| Literature: Dyson; George; Hunter Journal of the Chemical Society, 1926 , p. 3043 |
|
~%
1,3-bis(2,4-dic... CAS#:52477-05-1 |
| Literature: Dyson; George; Hunter Journal of the Chemical Society, 1926 , p. 3043 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| Thiourea,N,N'-bis(2,4-dichlorophenyl) |
| bis[(2,4-dichlorophenyl)amino]methane-1-thione |