chloromethyl (4-nitrophenyl)methyl carbonate
Modify Date: 2025-09-14 17:29:53
chloromethyl (4-nitrophenyl)methyl carbonate structure
|
Common Name | chloromethyl (4-nitrophenyl)methyl carbonate | ||
|---|---|---|---|---|
| CAS Number | 50780-46-6 | Molecular Weight | 245.61700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H8ClNO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | chloromethyl (4-nitrophenyl)methyl carbonate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H8ClNO5 |
|---|---|
| Molecular Weight | 245.61700 |
| Exact Mass | 245.00900 |
| PSA | 81.35000 |
| LogP | 2.96750 |
| InChIKey | JWEZYQWOGDUVLX-UHFFFAOYSA-N |
| SMILES | O=C(OCCl)OCc1ccc([N+](=O)[O-])cc1 |
|
~59%
chloromethyl (4... CAS#:50780-46-6 |
| Literature: Andrus, Alex; Heck, James V.; Christensen, Burton G.; Partridge, Beverly Journal of the American Chemical Society, 1984 , vol. 106, # 6 p. 1808 - 1811 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| chloromethyl 4-nitrobenzyl carbonate |
| p-nitrobenzylchloromethylcarbonate |