N-(2-acetylphenyl)-2-phenylacetamide
Modify Date: 2025-08-30 22:26:32
N-(2-acetylphenyl)-2-phenylacetamide structure
|
Common Name | N-(2-acetylphenyl)-2-phenylacetamide | ||
|---|---|---|---|---|
| CAS Number | 41296-66-6 | Molecular Weight | 253.29600 | |
| Density | 1.179g/cm3 | Boiling Point | 475.1ºC at 760 mmHg | |
| Molecular Formula | C16H15NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 187.6ºC | |
| Name | N-(2-acetylphenyl)-2-phenylacetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.179g/cm3 |
|---|---|
| Boiling Point | 475.1ºC at 760 mmHg |
| Molecular Formula | C16H15NO2 |
| Molecular Weight | 253.29600 |
| Flash Point | 187.6ºC |
| Exact Mass | 253.11000 |
| PSA | 49.66000 |
| LogP | 3.71990 |
| Index of Refraction | 1.615 |
| InChIKey | BJIHODFICUNNBW-UHFFFAOYSA-N |
| SMILES | CC(=O)c1ccccc1NC(=O)Cc1ccccc1 |
| HS Code | 2924299090 |
|---|
|
~%
N-(2-acetylphen... CAS#:41296-66-6 |
| Literature: Doleans-Jordheim, Anne; Veron, Jean-Baptiste; Fendrich, Olivier; Bergeron, Emmanuelle; Montagut-Romans, Adrien; Wong, Yung-Sing; Furdui, Bianca; Freney, Jean; Dumontet, Charles; Boumendjel, Ahcene ChemMedChem, 2013 , vol. 8, # 4 p. 652 - 657 |
|
~%
N-(2-acetylphen... CAS#:41296-66-6 |
| Literature: Camps Archiv der Pharmazie (Weinheim, Germany), 1901 , vol. 239, p. 597 |
CAS#:89081-06-1| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-Phenacetamino-acetophenon |
| 2'-acetyl-1-phenylacetanilide |
| Benzeneacetamide,N-(2-acetylphenyl) |
| Phenyl-essigsaeure-(2-acetyl-anilid) |
| Phenacetamido-2 acetophenone [French] |
| Phenacetamido-2 acetophenone |
| o-acetyl-N-(phenylacetyl)aniline |
| phenyl-acetic acid-(2-acetyl-anilide) |
| N-(2-Acetylphenyl)benzeneacetamide |