1,4-diamino-9,10-dioxoanthracene-2-carboxylic acid
1,4-diamino-9,10-dioxoanthracene-2-carboxylic acid structure
|
Common Name | 1,4-diamino-9,10-dioxoanthracene-2-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 4095-89-0 | Molecular Weight | 282.25100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H10N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,4-diamino-9,10-dioxoanthracene-2-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H10N2O4 |
|---|---|
| Molecular Weight | 282.25100 |
| Exact Mass | 282.06400 |
| PSA | 123.48000 |
| LogP | 2.48700 |
| InChIKey | DNIHCFWMWZCKCQ-UHFFFAOYSA-N |
| SMILES | Nc1cc(C(=O)O)c(N)c2c1C(=O)c1ccccc1C2=O |
| HS Code | 2922509090 |
|---|
|
~%
1,4-diamino-9,1... CAS#:4095-89-0 |
| Literature: Ciba-Geigy AG Patent: US4243600 A1, 1981 ; |
|
~%
1,4-diamino-9,1... CAS#:4095-89-0 |
| Literature: Ciba-Geigy AG Patent: US4243600 A1, 1981 ; |
|
~%
1,4-diamino-9,1... CAS#:4095-89-0 |
| Literature: Ciba-Geigy AG Patent: US4243600 A1, 1981 ; |
|
~%
1,4-diamino-9,1... CAS#:4095-89-0 |
| Literature: Kondratov, S. A.; Shteinberg, Ya. B.; Shein, S. M. J. Appl. Chem. USSR (Engl. Transl.), 1991 , vol. 64, # 12 p. 223 - 226,214 - 217 |
|
~%
1,4-diamino-9,1... CAS#:4095-89-0 |
| Literature: Agfa Patent: DE293100 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 12, p. 447 |
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| HMS2748D19 |
| 1,4-Diamino-9,10-dioxo-9,10-dihydro-anthracen-2-carbonsaeure |
| 1,4-diamino-9,10-dioxo-9,10-dihydro-anthracene-2-carboxylic acid |
| 1,4-diaminoanthraquinone-2-carboxylic acid |
| 1.4-Diamino-anthrachinon-carbonsaeure-(2) |