2-Anthroic acid, 1-amino-4-bromo-9,10-dihydro-9, 10-dioxo- structure
|
Common Name | 2-Anthroic acid, 1-amino-4-bromo-9,10-dihydro-9, 10-dioxo- | ||
|---|---|---|---|---|
| CAS Number | 6363-90-2 | Molecular Weight | 346.13200 | |
| Density | 1.821g/cm3 | Boiling Point | 613.3ºC at 760 mmHg | |
| Molecular Formula | C15H8BrNO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 324.7ºC | |
| Name | 1-amino-4-bromo-9,10-dioxoanthracene-2-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.821g/cm3 |
|---|---|
| Boiling Point | 613.3ºC at 760 mmHg |
| Molecular Formula | C15H8BrNO4 |
| Molecular Weight | 346.13200 |
| Flash Point | 324.7ºC |
| Exact Mass | 344.96400 |
| PSA | 97.46000 |
| LogP | 3.08610 |
| Index of Refraction | 1.751 |
| InChIKey | LFKLTGPCMCEKPE-UHFFFAOYSA-N |
| SMILES | Nc1c(C(=O)O)cc(Br)c2c1C(=O)c1ccccc1C2=O |
| HS Code | 2922509090 |
|---|
|
~%
2-Anthroic acid... CAS#:6363-90-2 |
| Literature: Monatshefte fuer Chemie, , vol. 34, p. 1016 Anm. 2 Helvetica Chimica Acta, , vol. 10, p. 654 |
| Precursor 1 | |
|---|---|
| DownStream 2 | |
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 1-amino-2-carboxy-4-bromoanthraquinone |
| 4-Brom-1-amino-anthrachinon-carbonsaeure-(2) |
| 1-amino-4-bromoanthraquinone-2carboxylic acid |
| 1-amino-4-bromo-9,10-dioxo-9,10-dihydroanthracene-2-carboxylic acid |
| 2-Anthracenecarboxylic acid,1-amino-4-bromo-9,10-dihydro-9,10-dioxo |
| 1-Amino-4-brom-9,10-dioxo-9,10-dihydro-anthracen-2-carbonsaeure |
| F1269-1249 |