1,1-diethyl-3-[2-fluoro-6-(trifluoromethyl)phenyl]urea structure
|
Common Name | 1,1-diethyl-3-[2-fluoro-6-(trifluoromethyl)phenyl]urea | ||
|---|---|---|---|---|
| CAS Number | 4037-50-7 | Molecular Weight | 278.24600 | |
| Density | 1.282g/cm3 | Boiling Point | 343ºC at 760 mmHg | |
| Molecular Formula | C12H14F4N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 161.3ºC | |
| Name | 1,1-diethyl-3-[2-fluoro-6-(trifluoromethyl)phenyl]urea |
|---|---|
| Synonym | More Synonyms |
| Density | 1.282g/cm3 |
|---|---|
| Boiling Point | 343ºC at 760 mmHg |
| Molecular Formula | C12H14F4N2O |
| Molecular Weight | 278.24600 |
| Flash Point | 161.3ºC |
| Exact Mass | 278.10400 |
| PSA | 35.83000 |
| LogP | 3.73180 |
| Vapour Pressure | 7.24E-05mmHg at 25°C |
| Index of Refraction | 1.493 |
| InChIKey | BOACQOQWFXYDFY-UHFFFAOYSA-N |
| SMILES | CCN(CC)C(=O)Nc1c(F)cccc1C(F)(F)F |
| HS Code | 2916399090 |
|---|
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 10,11-dihydro-5H-dibenzo[a,d]-cycloheptene-5-acetic acid |
| (10,11-dihydro-5H-dibenzo[a,d]cyclohepten-5-yl)-acetic acid |
| 5-Carboxymethyl-10,11-dihydro-5H-dibenzo[a,d]cyclohepten |