ethyl 1-amino-4-oxoquinolizine-3-carboxylate
Modify Date: 2025-11-27 18:46:18
ethyl 1-amino-4-oxoquinolizine-3-carboxylate structure
|
Common Name | ethyl 1-amino-4-oxoquinolizine-3-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 403500-03-8 | Molecular Weight | 232.23500 | |
| Density | 1.344g/cm3 | Boiling Point | 417.326ºC at 760 mmHg | |
| Molecular Formula | C12H12N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 206.192ºC | |
| Name | ethyl 1-amino-4-oxoquinolizine-3-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.344g/cm3 |
|---|---|
| Boiling Point | 417.326ºC at 760 mmHg |
| Molecular Formula | C12H12N2O3 |
| Molecular Weight | 232.23500 |
| Flash Point | 206.192ºC |
| Exact Mass | 232.08500 |
| PSA | 73.80000 |
| LogP | 1.63960 |
| Index of Refraction | 1.636 |
| InChIKey | VIZWCPWAXZFGOF-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1cc(N)c2ccccn2c1=O |
| HS Code | 2922509090 |
|---|
|
~56%
ethyl 1-amino-4... CAS#:403500-03-8 |
| Literature: Xu, Yi-Sheng; Zeng, Cheng-Chu; Jiao, Zi-Guo; Hu, Li-Ming; Zhong, Ru-Gang Molecules, 2009 , vol. 14, # 2 p. 868 - 883 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| ethyl 1-amino-4-oxo-4H-quinolizine-3-carboxylate |