6,7-dihydrodipyrido[1,2-b:1',2'-e]pyrazine-5,8-diium,dichloride structure
|
Common Name | 6,7-dihydrodipyrido[1,2-b:1',2'-e]pyrazine-5,8-diium,dichloride | ||
|---|---|---|---|---|
| CAS Number | 4032-26-2 | Molecular Weight | 255.14300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H12Cl2N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6,7-dihydrodipyrido[1,2-b:1',2'-e]pyrazine-5,8-diium,dichloride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H12Cl2N2 |
|---|---|
| Molecular Weight | 255.14300 |
| Exact Mass | 254.03800 |
| PSA | 7.76000 |
| InChIKey | SKYNPRKUXHXZFJ-UHFFFAOYSA-L |
| SMILES | [Cl-].[Cl-].c1cc[n+]2c(c1)-c1cccc[n+]1CC2 |
| HS Code | 2933990090 |
|---|
|
~%
6,7-dihydrodipy... CAS#:4032-26-2 |
| Literature: Fajardo; Lewis Journal of Physical Chemistry B, 1997 , vol. 101, # 51 p. 11136 - 11151 |
|
~%
6,7-dihydrodipy... CAS#:4032-26-2 |
| Literature: Fajardo; Lewis Journal of Physical Chemistry B, 1997 , vol. 101, # 51 p. 11136 - 11151 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Diquat hydrochloride |
| 6,7-dihydro-dipyrido[1,2-a,2',1'-c]pyrazinediylium,dichloride |
| 6,7-Dihydro-dipyrido[1,2-a,2',1'-c]pyrazindiylium,Dichlorid |
| Dipyrido(1,2-a |
| 1,1'-Ethylene-2,2'-dipyridinium dichloride |
| Diquat dichloride monohydrate |
| DIQUAT DICHLORIDE |
| 2',1'-c)pyrazinediium,6,7-dihydro-,dichloride |
| 1,1'-ethylene-2,2-bipyridyldiylium dichloride |
| EINECS 223-714-6 |
| 6,7-Dihydrodipyrido<1,2-a:2',1'-c>pyrazinium dichloride |