2-sulpho-2-phenylacetyl chloride
Modify Date: 2025-08-31 19:27:13
2-sulpho-2-phenylacetyl chloride structure
|
Common Name | 2-sulpho-2-phenylacetyl chloride | ||
|---|---|---|---|---|
| CAS Number | 40125-73-3 | Molecular Weight | 234.65700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H7ClO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-sulpho-2-phenylacetyl chloride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C8H7ClO4S |
|---|---|
| Molecular Weight | 234.65700 |
| Exact Mass | 233.97500 |
| PSA | 79.82000 |
| LogP | 2.46170 |
| InChIKey | PIMQVFSTMNWDMJ-UHFFFAOYSA-N |
| SMILES | O=C(Cl)C(c1ccccc1)S(=O)(=O)O |
| HS Code | 2914700090 |
|---|
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| d-(-)-alpha-sulfophenylacetyl chloride |
| alpha-sulfophenylacetyl chloride |