2-chloro-N-[1-(3,4-dimethylphenyl)ethyl]acetamide structure
|
Common Name | 2-chloro-N-[1-(3,4-dimethylphenyl)ethyl]acetamide | ||
|---|---|---|---|---|
| CAS Number | 40023-05-0 | Molecular Weight | 225.71500 | |
| Density | 1.096g/cm3 | Boiling Point | 393.6ºC at 760mmHg | |
| Molecular Formula | C12H16ClNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 191.8ºC | |
| Name | 2-chloro-N-[1-(3,4-dimethylphenyl)ethyl]acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.096g/cm3 |
|---|---|
| Boiling Point | 393.6ºC at 760mmHg |
| Molecular Formula | C12H16ClNO |
| Molecular Weight | 225.71500 |
| Flash Point | 191.8ºC |
| Exact Mass | 225.09200 |
| PSA | 32.59000 |
| LogP | 3.55970 |
| Index of Refraction | 1.525 |
| InChIKey | BBIQIWUWCIMXDN-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C(C)NC(=O)CCl)cc1C |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-chloro-N-[1-(3,4-dimethyl-phenyl)-ethyl]-acetamide |