2-chloro-N-[1-(3,4-dichlorophenyl)ethyl]acetamide structure
|
Common Name | 2-chloro-N-[1-(3,4-dichlorophenyl)ethyl]acetamide | ||
|---|---|---|---|---|
| CAS Number | 90793-96-7 | Molecular Weight | 266.55200 | |
| Density | 1.351g/cm3 | Boiling Point | 420.4ºC at 760mmHg | |
| Molecular Formula | C10H10Cl3NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 208ºC | |
| Name | 2-chloro-N-[1-(3,4-dichlorophenyl)ethyl]acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.351g/cm3 |
|---|---|
| Boiling Point | 420.4ºC at 760mmHg |
| Molecular Formula | C10H10Cl3NO |
| Molecular Weight | 266.55200 |
| Flash Point | 208ºC |
| Exact Mass | 264.98300 |
| PSA | 32.59000 |
| LogP | 4.24970 |
| Index of Refraction | 1.555 |
| InChIKey | IGSLPFRVZBFLCQ-UHFFFAOYSA-N |
| SMILES | CC(NC(=O)CCl)c1ccc(Cl)c(Cl)c1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-chloro-N-[1-(3,4-dichloro-phenyl)-ethyl]-acetamide |