(4-methoxyphenyl)methyl 2,2,2-trifluoroacetate structure
|
Common Name | (4-methoxyphenyl)methyl 2,2,2-trifluoroacetate | ||
|---|---|---|---|---|
| CAS Number | 38696-08-1 | Molecular Weight | 234.17200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H9F3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (4-methoxyphenyl)methyl 2,2,2-trifluoroacetate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H9F3O3 |
|---|---|
| Molecular Weight | 234.17200 |
| Exact Mass | 234.05000 |
| PSA | 35.53000 |
| LogP | 2.30070 |
| InChIKey | BSBVVLYNTXIZSP-UHFFFAOYSA-N |
| SMILES | COc1ccc(COC(=O)C(F)(F)F)cc1 |
|
~94%
(4-methoxypheny... CAS#:38696-08-1 |
| Literature: Yang, Zhigang; Zhou, Jianrong Journal of the American Chemical Society, 2012 , vol. 134, # 29 p. 11833 - 11835 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| p-methoxybenzyl trifluoroacetate |
| (p-Methoxy-benzyl)trifluoracetat |
| 4-Methoxybenzyl trifluoroacetate |
| Trifluoroacetic acid,4-methoxybenzyl ester |
| 4-Methoxybenzyl-trifluoracetat |
| Acetic acid,trifluoro-,(4-methoxyphenyl)methyl ester |