1,2-dibromo-3,3,6,6-tetramethylcyclohexene structure
|
Common Name | 1,2-dibromo-3,3,6,6-tetramethylcyclohexene | ||
|---|---|---|---|---|
| CAS Number | 37490-74-7 | Molecular Weight | 296.04200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H16Br2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,2-dibromo-3,3,6,6-tetramethylcyclohexene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H16Br2 |
|---|---|
| Molecular Weight | 296.04200 |
| Exact Mass | 293.96200 |
| LogP | 4.83400 |
| InChIKey | GAIMFYPYRSBIMI-UHFFFAOYSA-N |
| SMILES | CC1(C)CCC(C)(C)C(Br)=C1Br |
|
~%
1,2-dibromo-3,3... CAS#:37490-74-7 |
| Literature: Applequist,D.E. et al. Journal of the American Chemical Society, 1972 , vol. 94, # 12 p. 4272 - 4278 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| 1,2-Dibrom-3,3,6,6-tetramethylcyclohexen |
| Cyclohexene,1,2-dibromo-3,3,6,6-tetramethyl |