1,2,4,5-Tetroxane,3,3,6,6-tetrapropyl- structure
|
Common Name | 1,2,4,5-Tetroxane,3,3,6,6-tetrapropyl- | ||
|---|---|---|---|---|
| CAS Number | 55208-76-9 | Molecular Weight | 260.37000 | |
| Density | 0.917g/cm3 | Boiling Point | 275.3ºC at 760mmHg | |
| Molecular Formula | C14H28O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 95.3ºC | |
| Name | 3,3,6,6-tetrapropyl-1,2,4,5-tetraoxane |
|---|---|
| Synonym | More Synonyms |
| Density | 0.917g/cm3 |
|---|---|
| Boiling Point | 275.3ºC at 760mmHg |
| Molecular Formula | C14H28O4 |
| Molecular Weight | 260.37000 |
| Flash Point | 95.3ºC |
| Exact Mass | 260.19900 |
| PSA | 36.92000 |
| LogP | 4.48940 |
| Index of Refraction | 1.416 |
| InChIKey | RNUOEHJMGLWQPM-UHFFFAOYSA-N |
| SMILES | CCCC1(CCC)OOC(CCC)(CCC)OO1 |
|
~43%
1,2,4,5-Tetroxa... CAS#:55208-76-9 |
| Literature: Zmitek, Katja; Stavber, Stojan; Zupan, Marko; Bonnet-Delpon, Daniele; Charneau, Sebastien; Grellier, Phillipe; Iskra, Jernej Bioorganic and Medicinal Chemistry, 2006 , vol. 14, # 23 p. 7790 - 7795 |
| 3,3,6,6-Tetra-n-propyl-1,2,4,5-tetroxan |
| 3,3,6,6-tetrapropyl-1,2,4,5-tetraoxone |
| 3,3,6,6-tetra-n-propyl-1,2,4,5-tetraoxacyclohexane |