sodium,oxolane-2,5-dione,2,4,4-trimethylpent-1-ene structure
|
Common Name | sodium,oxolane-2,5-dione,2,4,4-trimethylpent-1-ene | ||
|---|---|---|---|---|
| CAS Number | 37199-81-8 | Molecular Weight | 235.27500 | |
| Density | N/A | Boiling Point | 101.4ºC at 760mmHg | |
| Molecular Formula | C12H20NaO3+ | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | sodium,oxolane-2,5-dione,2,4,4-trimethylpent-1-ene |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 101.4ºC at 760mmHg |
|---|---|
| Molecular Formula | C12H20NaO3+ |
| Molecular Weight | 235.27500 |
| Exact Mass | 235.13100 |
| PSA | 43.37000 |
| LogP | 2.84870 |
| InChIKey | JHBKNJSZAQSDFP-UHFFFAOYSA-N |
| SMILES | C=C(C)CC(C)(C)C.O=C1CCC(=O)O1.[Na+] |
| Maleic anhydride,polymer with 2,4,4-trimethylpentene,sodium salt |
| 2,5-furandione,dihydro-,compd. with 2,4,4-trimethyl-1-pentene,sodium salt (1:1:1) |
| 2,5-Furandione,polymer with 2,4,4-trimethylpentene,sodium salt |
| Maleic anhydride 2,4,4-trimethylpentene polymer sodium salt |