Antioxidant structure
|
Common Name | Antioxidant | ||
|---|---|---|---|---|
| CAS Number | 68411-46-1 | Molecular Weight | 361.563 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 462.7±34.0 °C at 760 mmHg | |
| Molecular Formula | C26H35N | Melting Point | 95ºC | |
| MSDS | N/A | Flash Point | 238.9±21.1 °C | |
| Name | Benzenamine, N-phenyl, reaction products with 2,4,4-trimethylpentene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 462.7±34.0 °C at 760 mmHg |
| Melting Point | 95ºC |
| Molecular Formula | C26H35N |
| Molecular Weight | 361.563 |
| Flash Point | 238.9±21.1 °C |
| Exact Mass | 361.276947 |
| PSA | 12.03000 |
| LogP | 8.68 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.552 |
| InChIKey | NRBLRTXFXBXILY-UHFFFAOYSA-N |
| SMILES | C=C(C)CC(C)(C)C.c1ccc(Nc2ccccc2)cc1 |
| N-phenylaniline,2,4,4-trimethylpent-1-ene |
| 4-(2,2,3-Trimethyl-3-buten-1-yl)-N-[4-(2,2,3-trimethyl-3-buten-1-yl)phenyl]aniline |
| Benzenamine, 4-(2,2,3-trimethyl-3-buten-1-yl)-N-[4-(2,2,3-trimethyl-3-buten-1-yl)phenyl]- |
| Antioxidant |