3-(diethylamino)propyl 2-ethoxy-2,2-diphenylacetate structure
|
Common Name | 3-(diethylamino)propyl 2-ethoxy-2,2-diphenylacetate | ||
|---|---|---|---|---|
| CAS Number | 3626-03-7 | Molecular Weight | 369.49700 | |
| Density | 1.05g/cm3 | Boiling Point | 482ºC at 760 mmHg | |
| Molecular Formula | C23H31NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 245.3ºC | |
| Name | 3-(diethylamino)propyl 2-ethoxy-2,2-diphenylacetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.05g/cm3 |
|---|---|
| Boiling Point | 482ºC at 760 mmHg |
| Molecular Formula | C23H31NO3 |
| Molecular Weight | 369.49700 |
| Flash Point | 245.3ºC |
| Exact Mass | 369.23000 |
| PSA | 38.77000 |
| LogP | 4.24180 |
| Index of Refraction | 1.53 |
| InChIKey | RWRUUZFOYYRACJ-UHFFFAOYSA-N |
| SMILES | CCOC(C(=O)OCCCN(CC)CC)(c1ccccc1)c1ccccc1 |
| HS Code | 2922509090 |
|---|
|
~%
3-(diethylamino... CAS#:3626-03-7 |
| Literature: Doyle,F.P. et al. Journal of Medicinal Chemistry, 1965 , vol. 8, p. 571 - 576 |
|
~%
3-(diethylamino... CAS#:3626-03-7 |
| Literature: Doyle,F.P. et al. Journal of Medicinal Chemistry, 1965 , vol. 8, p. 571 - 576 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Etpenal-3 |
| 3-Diethylaminopropyl-o-ethylbenzilate |
| Etpenal-14 |
| Ethpenal |