2-chloro-1-(4-chlorophenyl)-2-methylpropan-1-one structure
|
Common Name | 2-chloro-1-(4-chlorophenyl)-2-methylpropan-1-one | ||
|---|---|---|---|---|
| CAS Number | 36025-21-5 | Molecular Weight | 217.09200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H10Cl2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-chloro-1-(4-chlorophenyl)-2-methylpropan-1-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H10Cl2O |
|---|---|
| Molecular Weight | 217.09200 |
| Exact Mass | 216.01100 |
| PSA | 17.07000 |
| LogP | 3.54010 |
| InChIKey | SFFMIORDYVFMAI-UHFFFAOYSA-N |
| SMILES | CC(C)(Cl)C(=O)c1ccc(Cl)cc1 |
| HS Code | 2914700090 |
|---|
|
~%
2-chloro-1-(4-c... CAS#:36025-21-5 |
| Literature: Dow Chem.Co. Patent: US2855439 , 1956 ; |
|
~%
2-chloro-1-(4-c... CAS#:36025-21-5 |
| Literature: Soundararajan, N.; Jackson, James E.; Platz, Matthew S.; Liu, Michael T. H. Tetrahedron Letters, 1988 , vol. 29, # 28 p. 3419 - 3422 |
| Precursor 4 | |
|---|---|
| DownStream 0 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 2-Chlor-1-(4-chlor-phenyl)-2-methyl-propan-1-on |
| Isobutyrophenone,2,4'-dichloro |
| 1-Propanone,2-chloro-1-(4-chlorophenyl)-2-methyl |
| 2-chloro-1-(4-chloro-phenyl)-2-methyl-propan-1-one |