N-propyl-5-(3,4,5-trimethoxyphenyl)-1,3,4-thiadiazol-2-amine structure
|
Common Name | N-propyl-5-(3,4,5-trimethoxyphenyl)-1,3,4-thiadiazol-2-amine | ||
|---|---|---|---|---|
| CAS Number | 35313-96-3 | Molecular Weight | 309.38400 | |
| Density | 1.212g/cm3 | Boiling Point | 447.7ºC at 760 mmHg | |
| Molecular Formula | C14H19N3O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 224.5ºC | |
| Name | N-propyl-5-(3,4,5-trimethoxyphenyl)-1,3,4-thiadiazol-2-amine |
|---|
| Density | 1.212g/cm3 |
|---|---|
| Boiling Point | 447.7ºC at 760 mmHg |
| Molecular Formula | C14H19N3O3S |
| Molecular Weight | 309.38400 |
| Flash Point | 224.5ºC |
| Exact Mass | 309.11500 |
| PSA | 96.97000 |
| LogP | 2.47470 |
| Index of Refraction | 1.575 |
| InChIKey | AFYJNRSBGAYFMH-UHFFFAOYSA-N |
| SMILES | CCCNc1nnc(-c2cc(OC)c(OC)c(OC)c2)s1 |
|
~%
N-propyl-5-(3,4... CAS#:35313-96-3 |
| Literature: Mhasalkar; Shah; Pilankar; Nikam; Anantanarayanan; Deliwala Journal of medicinal chemistry, 1971 , vol. 14, # 10 p. 1000 - 1003 |