2-bromo-5,6-dimethoxy-3-methylbenzene-1,4-diol structure
|
Common Name | 2-bromo-5,6-dimethoxy-3-methylbenzene-1,4-diol | ||
|---|---|---|---|---|
| CAS Number | 34417-79-3 | Molecular Weight | 263.08500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H11BrO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-bromo-5,6-dimethoxy-3-methylbenzene-1,4-diol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H11BrO4 |
|---|---|
| Molecular Weight | 263.08500 |
| Exact Mass | 261.98400 |
| PSA | 58.92000 |
| LogP | 2.18590 |
| InChIKey | XDEHJBMWKOQGKG-UHFFFAOYSA-N |
| SMILES | COc1c(O)c(C)c(Br)c(O)c1OC |
|
~95%
2-bromo-5,6-dim... CAS#:34417-79-3 |
| Literature: Fujita, Yoshiji; Ishiguro, Michihiro; Onishi, Takashi; Nishida, Takashi Synthesis, 1981 , # 6 p. 469 - 471 |
|
~96%
2-bromo-5,6-dim... CAS#:34417-79-3 |
| Literature: Matsushita, Hajime; Ishiguro, Shigeo Agricultural and Biological Chemistry, 1985 , vol. 49, # 10 p. 3071 - 3072 |
|
~%
2-bromo-5,6-dim... CAS#:34417-79-3 |
| Literature: Sato; Inoue; Yamaguchi The Journal of organic chemistry, 1972 , vol. 37, # 12 p. 1889 - 1892 |
| 6-bromo-2,3-dimethoxy-5-methylhydroquinone |
| 2,3-dimethoxy-5-methyl-6-bromohydroquinone |
| 6-Brom-2,3-dimethoxy-5-methylhydrochinon |
| 1,4-Benzenediol,2-bromo-5,6-dimethoxy-3-methyl |
| 1,6-Dimethyl-2,5-dihydroxy-3-bromo-4-methylbenzol |
| 2,3-dimethoxy-5-bromo-6-methyl-1,4-hydroquinone |