2,3,4,4,5,6-hexamethyl-2,6-bis(2-methylbutan-2-ylperoxy)heptane structure
|
Common Name | 2,3,4,4,5,6-hexamethyl-2,6-bis(2-methylbutan-2-ylperoxy)heptane | ||
|---|---|---|---|---|
| CAS Number | 3052-70-8 | Molecular Weight | 388.62500 | |
| Density | 0.894g/cm3 | Boiling Point | 401.1ºC at 760 mmHg | |
| Molecular Formula | C23H48O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 139.5ºC | |
| Name | 2,3,4,4,5,6-hexamethyl-2,6-bis(2-methylbutan-2-ylperoxy)heptane |
|---|---|
| Synonym | More Synonyms |
| Density | 0.894g/cm3 |
|---|---|
| Boiling Point | 401.1ºC at 760 mmHg |
| Molecular Formula | C23H48O4 |
| Molecular Weight | 388.62500 |
| Flash Point | 139.5ºC |
| Exact Mass | 388.35500 |
| PSA | 36.92000 |
| LogP | 7.11560 |
| Index of Refraction | 1.443 |
| InChIKey | PHIGUQOUWMSXFV-UHFFFAOYSA-N |
| SMILES | CCC(C)(C)OOC(C)(C)OOC(C)(C)CC |
| HS Code | 2909600000 |
|---|
|
~%
2,3,4,4,5,6-hex... CAS#:3052-70-8 |
| Literature: Nazarova,Z.F. et al. J. Gen. Chem. USSR (Engl. Transl.), 1964 , vol. 34, p. 2430 - 2432,2444 - 2446 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2909600000 |
|---|---|
| Summary | 2909600000 alcohol peroxides, ether peroxides, ketone peroxides and their halogenated, sulphonated, nitrated or nitrosated derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| 2,2-Bis-tert.-pentylepidioxy-propan |