1-(4-methylphenyl)sulfinyl-2-nitrobenzene structure
|
Common Name | 1-(4-methylphenyl)sulfinyl-2-nitrobenzene | ||
|---|---|---|---|---|
| CAS Number | 29787-22-2 | Molecular Weight | 261.29600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H11NO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(4-methylphenyl)sulfinyl-2-nitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H11NO3S |
|---|---|
| Molecular Weight | 261.29600 |
| Exact Mass | 261.04600 |
| PSA | 82.10000 |
| LogP | 4.45880 |
| InChIKey | NLGBOIUKPNEXTR-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)c2ccccc2[N+](=O)[O-])cc1 |
|
~%
1-(4-methylphen... CAS#:29787-22-2 |
| Literature: Tanikaga,R.; Kaji,A. Bulletin of the Chemical Society of Japan, 1973 , vol. 46, # 12 p. 3814 - 3817 |
|
~%
1-(4-methylphen... CAS#:29787-22-2 |
| Literature: Tanikaga,R.; Kaji,A. Bulletin of the Chemical Society of Japan, 1973 , vol. 46, # 12 p. 3814 - 3817 |
|
~%
1-(4-methylphen... CAS#:29787-22-2 |
| Literature: Tanikaga,R.; Kaji,A. Bulletin of the Chemical Society of Japan, 1973 , vol. 46, # 12 p. 3814 - 3817 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 2NO2Ph-SO-4MePh |
| 4'-Tolyl-2-nitrophenylsulfoxid |
| 2-Nitrophenyl 4-methylphenyl sulfoxide |