2-(3-nitrophenyl)furan structure
|
Common Name | 2-(3-nitrophenyl)furan | ||
|---|---|---|---|---|
| CAS Number | 28988-01-4 | Molecular Weight | 189.16700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H7NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(3-nitrophenyl)furan |
|---|
| Molecular Formula | C10H7NO3 |
|---|---|
| Molecular Weight | 189.16700 |
| Exact Mass | 189.04300 |
| PSA | 58.96000 |
| LogP | 3.37800 |
| InChIKey | ORTCGUMURUBCPP-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cccc(-c2ccco2)c1 |
|
~%
2-(3-nitropheny... CAS#:28988-01-4 |
| Literature: Hari, Durga Prasad; Schroll, Peter; Koenig, Burkhard Journal of the American Chemical Society, 2012 , vol. 134, # 6 p. 2958 - 2961 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |