3-(1H-indol-3-yl)-1-(4-methylphenyl)-3-phenylpropan-1-one structure
|
Common Name | 3-(1H-indol-3-yl)-1-(4-methylphenyl)-3-phenylpropan-1-one | ||
|---|---|---|---|---|
| CAS Number | 27224-29-9 | Molecular Weight | 339.43000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H21NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-(1H-indol-3-yl)-1-(4-methylphenyl)-3-phenylpropan-1-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C24H21NO |
|---|---|
| Molecular Weight | 339.43000 |
| Exact Mass | 339.16200 |
| PSA | 32.86000 |
| LogP | 5.88120 |
| InChIKey | VDZVNQJBYCJIFD-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C(=O)CC(c2ccccc2)c2c[nH]c3ccccc23)cc1 |
|
~94%
3-(1H-indol-3-y... CAS#:27224-29-9 |
| Literature: Wang, Shun-Yi; Ji, Shun-Jun; Loh, Teck-Peng Synlett, 2003 , # 15 p. 2377 - 2379 |
|
~92%
3-(1H-indol-3-y... CAS#:27224-29-9 |
| Literature: Ghorbani-Vaghei; Hajinazari; Engashte Journal of the Iranian Chemical Society, 2012 , vol. 9, # 5 p. 655 - 660 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 1-Propanone,3-(1H-indol-3-yl)-1-(4-methylphenyl)-3-phenyl |
| 3-Phenyl-1-n-tolyl-3-(indolyl-3')-1-oxopropan |
| 3-indol-3-yl-3-phenyl-1-p-tolyl-propan-1-one |