(2,5-dichlorophenyl)-(4-hydroxyphenyl)methanone structure
|
Common Name | (2,5-dichlorophenyl)-(4-hydroxyphenyl)methanone | ||
|---|---|---|---|---|
| CAS Number | 270903-84-9 | Molecular Weight | 267.10700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H8Cl2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (2,5-dichlorophenyl)-(4-hydroxyphenyl)methanone |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H8Cl2O2 |
|---|---|
| Molecular Weight | 267.10700 |
| Exact Mass | 265.99000 |
| PSA | 37.30000 |
| LogP | 3.93000 |
| InChIKey | BVTAAMCWUFECHC-UHFFFAOYSA-N |
| SMILES | O=C(c1ccc(O)cc1)c1cc(Cl)ccc1Cl |
|
~83%
(2,5-dichloroph... CAS#:270903-84-9 |
| Literature: JSR Corporation Patent: US2008/15389 A1, 2008 ; Location in patent: Page/Page column 15 ; |
|
~%
(2,5-dichloroph... CAS#:270903-84-9 |
| Literature: Simpson; Stephenson Journal of the Chemical Society, 1942 , p. 353,356 |
| 2,5-Dichlor-4'-hydroxy-benzophenon |
| 2,5-dichloro-4'-hydroxybenzophenone |
| Methanone,(2,5-dichlorophenyl)(4-hydroxyphenyl) |