bis(3-nitrophenyl)mercury structure
|
Common Name | bis(3-nitrophenyl)mercury | ||
|---|---|---|---|---|
| CAS Number | 26953-06-0 | Molecular Weight | 444.79300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H8HgN2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | bis(3-nitrophenyl)mercury |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H8HgN2O4 |
|---|---|
| Molecular Weight | 444.79300 |
| Exact Mass | 446.01900 |
| PSA | 57.50000 |
| LogP | 2.17250 |
| InChIKey | FKWQEOORUJGYPR-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cccc([Hg]c2cccc([N+](=O)[O-])c2)c1 |
|
~%
bis(3-nitrophen... CAS#:26953-06-0 |
| Literature: Challenger; Richards Journal of the Chemical Society, 1934 , p. 405,408 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| Mercury,bis(3-nitrophenyl) |
| bis(m-nitrophenyl)mercury |
| Bis-(3-nitro-phenyl)-quecksilber |
| bis-(3-nitro-phenyl)-mercury |