Bis(3-nitrophenyl)sulfone structure
|
Common Name | Bis(3-nitrophenyl)sulfone | ||
|---|---|---|---|---|
| CAS Number | 1228-53-1 | Molecular Weight | 308.267 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 525.8±35.0 °C at 760 mmHg | |
| Molecular Formula | C12H8N2O6S | Melting Point | 252-255°C | |
| MSDS | N/A | Flash Point | 271.8±25.9 °C | |
| Name | 1-nitro-3-(3-nitrophenyl)sulfonylbenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 525.8±35.0 °C at 760 mmHg |
| Melting Point | 252-255°C |
| Molecular Formula | C12H8N2O6S |
| Molecular Weight | 308.267 |
| Flash Point | 271.8±25.9 °C |
| Exact Mass | 308.010315 |
| PSA | 134.16000 |
| LogP | 2.85 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Index of Refraction | 1.637 |
| InChIKey | AKAXCFAQCKRJOT-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cccc(S(=O)(=O)c2cccc([N+](=O)[O-])c2)c1 |
| RTECS | WR4700000 |
|---|---|
| HS Code | 2904909090 |
|
~%
Bis(3-nitrophen... CAS#:1228-53-1 |
| Literature: Synthesis, , # 8 p. 1065 - 1071 |
|
~%
Bis(3-nitrophen... CAS#:1228-53-1
Detail
|
| Literature: Synthesis, , # 8 p. 1065 - 1071 |
|
~%
Bis(3-nitrophen... CAS#:1228-53-1 |
| Literature: Gazzetta Chimica Italiana, , vol. 76, p. 113,119 |
|
~%
Bis(3-nitrophen... CAS#:1228-53-1 |
| Literature: Comptes Rendus Hebdomadaires des Seances de l'Academie des Sciences, , vol. 173, p. 777 |
|
~%
Bis(3-nitrophen... CAS#:1228-53-1 |
| Literature: Bollettino Scientifico della Facolta di Chimica Industriale di Bologna, , vol. 13, p. 48,52 |
|
~%
Bis(3-nitrophen... CAS#:1228-53-1 |
| Literature: Chemische Berichte, , vol. 9, p. 79 |
|
~%
Bis(3-nitrophen... CAS#:1228-53-1 |
| Literature: Synthesis, , # 8 p. 1065 - 1071 |
|
~%
Bis(3-nitrophen... CAS#:1228-53-1 |
| Literature: Gazzetta Chimica Italiana, , vol. 76, p. 113,119 |
|
~%
Bis(3-nitrophen... CAS#:1228-53-1
Detail
|
| Literature: Gazzetta Chimica Italiana, , vol. 76, p. 113,119 |
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 3,3'-Dinitrodiphenylsulfone |
| Bis(m-nitrophenyl)sulfone |
| 3,3'-Dinitrodiphenylsulphone |
| Bis-(3-nitro-phenyl)-sulfon |
| 3-NITROPHENYL SULFONE |
| EINECS 214-965-2 |
| 3,3'-sulfonylbis(nitrobenzene) |
| Sulfone,bis(m-nitrophenyl) |
| Bis(3-nitrophenyl)sulfone |
| Sulfone, bis(m-nitrophenyl) |
| 3.3'-Dinitro-diphenylsulfon |
| 1,1'-Sulfonylbis(3-nitrobenzene) |
| 3,3'-dinitrodiphenyl sulfone |
| Benzene, 1,1'-sulfonylbis[3-nitro- |
| MFCD00040973 |
| Bis(3-nitrophenyl) sulfone |