RMC-4998 structure
|
Common Name | RMC-4998 | ||
|---|---|---|---|---|
| CAS Number | 2642037-07-6 | Molecular Weight | 983.25 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C57H74N8O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of RMC-4998RMC-4998 is a molecular glue compound with good antitumor activity. RMC-4998 is able to form a ternary complex with CYPA and an activated KRAS G12C mutant. Furthermore, CYPA binding to KRAS G12C blocks the interaction between activated KRAS mutants and downstream effector proteins, thereby inhibiting signaling that promotes cell proliferation[1]. |
| Name | RMC-4998 |
|---|
| Description | RMC-4998 is a molecular glue compound with good antitumor activity. RMC-4998 is able to form a ternary complex with CYPA and an activated KRAS G12C mutant. Furthermore, CYPA binding to KRAS G12C blocks the interaction between activated KRAS mutants and downstream effector proteins, thereby inhibiting signaling that promotes cell proliferation[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C57H74N8O7 |
|---|---|
| Molecular Weight | 983.25 |
| InChIKey | VYZILERTWJIGRC-DOESOIHZSA-N |
| SMILES | CCn1c(-c2cccnc2C(C)OC)c2c3cc(ccc31)-c1cccc(c1)CC(NC(=O)C(C(C)C)N1CCC3(CCN(C(=O)C#CC(C)(C)N(C)C)C3)C1=O)C(=O)N1CCCC(N1)C(=O)OCC(C)(C)C2 |