PSMA I&S structure
|
Common Name | PSMA I&S | ||
|---|---|---|---|---|
| CAS Number | 2639475-07-1 | Molecular Weight | 1299.40 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C59H82N10O21S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of PSMA I&SPSMA I&S is a precursor of the 99mTc-labeled PSMA-targeting ligand[1]. |
| Name | PSMA I&S |
|---|
| Description | PSMA I&S is a precursor of the 99mTc-labeled PSMA-targeting ligand[1]. |
|---|---|
| Related Catalog |
| Molecular Formula | C59H82N10O21S |
|---|---|
| Molecular Weight | 1299.40 |
| InChIKey | WHHMZTBDVJHXFV-POUOUQAISA-N |
| SMILES | O=C(O)CCC(NC(=O)NC(CCCCNC(=O)CCCCCCC(=O)NCCCCC(NC(=O)C(Cc1ccc2ccccc2c1)NC(=O)C(Cc1ccc(O)cc1)NC(=O)C(CO)NC(=O)C(CO)NC(=O)C(CO)NC(=O)CS)C(=O)O)C(=O)O)C(=O)O |