HPK1-IN-38
Modify Date: 2025-09-22 11:49:27
HPK1-IN-38 structure
|
Common Name | HPK1-IN-38 | ||
|---|---|---|---|---|
| CAS Number | 2578802-72-7 | Molecular Weight | 495.57 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C29H29N5O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of HPK1-IN-38HPK1-IN-38 (compound 15) is a MAP4K1/HPK1 inhibitor，can be used for HPK1 related disorders research[1]. |
| Name | HPK1-IN-38 |
|---|
| Description | HPK1-IN-38 (compound 15) is a MAP4K1/HPK1 inhibitor，can be used for HPK1 related disorders research[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C29H29N5O3 |
|---|---|
| Molecular Weight | 495.57 |
| InChIKey | BBLKEGCHGUMNSD-UHFFFAOYSA-N |
| SMILES | COc1cc(-c2cnc3[nH]cc(-c4ccc(C(=O)N5CC6(COC6)C5)cc4)c3n2)cc2c1CN(C)CC2 |