2,4-D-trolamine structure
|
Common Name | 2,4-D-trolamine | ||
|---|---|---|---|---|
| CAS Number | 2569-01-9 | Molecular Weight | 370.22600 | |
| Density | N/A | Boiling Point | 342.2ºC at 760 mmHg | |
| Molecular Formula | C14H21Cl2NO6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 160.8ºC | |
| Name | 2,4-D-trolamine |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 342.2ºC at 760 mmHg |
|---|---|
| Molecular Formula | C14H21Cl2NO6 |
| Molecular Weight | 370.22600 |
| Flash Point | 160.8ºC |
| Exact Mass | 369.07500 |
| PSA | 110.46000 |
| LogP | 0.72210 |
| Vapour Pressure | 2.94E-05mmHg at 25°C |
| InChIKey | OLHMQEQGSVBLTJ-UHFFFAOYSA-N |
| SMILES | O=C(O)COc1ccc(Cl)cc1Cl.OCCN(CCO)CCO |
CHEMICAL IDENTIFICATION
|
| RIDADR | UN 3345 |
|---|---|
| Packaging Group | III |
| Hazard Class | 6.1(b) |
|
~95%
2,4-D-trolamine CAS#:2569-01-9 |
| Literature: Voronkov, M. G.; Semenova, N. V.; Kazimirovskaya, V. B.; Kholdeeva, L. N.; Moskvitina, L. T.; et al. Pharmaceutical Chemistry Journal, 1986 , vol. 20, # 8 p. 555 - 558 Khimiko-Farmatsevticheskii Zhurnal, 1986 , vol. 20, # 8 p. 952 - 956 |
| 2-(2,4-dichlorophenoxy)acetic acid compound with 2,2’,2″-nitrilotris[ethanol] (1:1) |
| Triethanolamine 2,4-dichlorophenoxyacetate |
| tris(2-hydroxyethyl)ammonium (2,4-dichlorophenoxy)acetate |
| 2,4-Dichlorophenoxyacetic acid triethanolamine salt |
| (2,4-dichlorophenoxy)acetic acid—2,2’,2″-nitrilotri(ethan-1-ol) |
| (2,4-dichlorophenoxy)acetic acid - 2,2’,2″-nitrilotriethanol (1:1) |
| 2,4-d triethanolamine salt |
| triethanolamine salt of 2,4-D |
| 2,4-dichlorophenoxyacetic acid triethanolamine |