fluoropentachloroacetone structure
|
Common Name | fluoropentachloroacetone | ||
|---|---|---|---|---|
| CAS Number | 2378-08-7 | Molecular Weight | 248.29500 | |
| Density | 1.803g/cm3 | Boiling Point | 170.7ºC at 760mmHg | |
| Molecular Formula | C3Cl5FO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 57ºC | |
| Name | 1,1,1,3,3-pentachloro-3-fluoropropan-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.803g/cm3 |
|---|---|
| Boiling Point | 170.7ºC at 760mmHg |
| Molecular Formula | C3Cl5FO |
| Molecular Weight | 248.29500 |
| Flash Point | 57ºC |
| Exact Mass | 245.83800 |
| PSA | 17.07000 |
| LogP | 3.02660 |
| Vapour Pressure | 1.45mmHg at 25°C |
| Index of Refraction | 1.462 |
| InChIKey | VODZXUJSDKOZEW-UHFFFAOYSA-N |
| SMILES | O=C(C(F)(Cl)Cl)C(Cl)(Cl)Cl |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36/37/39-45 |
| RIDADR | UN 3265 |
| HS Code | 2914700090 |
|
~%
fluoropentachlo... CAS#:2378-08-7 |
| Literature: The Dow Chemical Company Patent: US4562009 A1, 1985 ; |
|
~%
fluoropentachlo... CAS#:2378-08-7 |
| Literature: Pews, R. Garth; Lysenko, Zenon Journal of Organic Chemistry, 1985 , vol. 50, # 25 p. 5115 - 5119 |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| FLUOROPENTACHLOROACETONE |
| pentachloro-fluoro-acetone |
| 1,1,1,3,3-pentachloro-3-fluoro-propan-2-one |
| Pentachlor-fluor-aceton |
| 1,1,1,3,3-pentachloro-3-fluoroacetone |