Sulfo-NHS-Acetate sodium structure
|
Common Name | Sulfo-NHS-Acetate sodium | ||
|---|---|---|---|---|
| CAS Number | 221222-61-3 | Molecular Weight | 259.17 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H6NNaO7S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Sulfo-NHS-Acetate sodiumSulfo-NHS-Acetate sodium is an alkyl chain-based PROTAC linker. Sulfo-NHS-Acetate sodium can be used in the synthesis of PROTACs[1]. |
| Name | Sulfo-NHS-Acetate sodium |
|---|
| Description | Sulfo-NHS-Acetate sodium is an alkyl chain-based PROTAC linker. Sulfo-NHS-Acetate sodium can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
Alkyl-Chain |
| References |
| Molecular Formula | C6H6NNaO7S |
|---|---|
| Molecular Weight | 259.17 |
| InChIKey | VGYOVKDAMGIIJU-UHFFFAOYSA-M |
| SMILES | CC(=O)ON1C(=O)CC(S(=O)(=O)[O-])C1=O.[Na+] |