Thymidine diphosphate-L-rhamnose structure
|
Common Name | Thymidine diphosphate-L-rhamnose | ||
|---|---|---|---|---|
| CAS Number | 2147-59-3 | Molecular Weight | 548.330 | |
| Density | 1.8±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C16H26N2O15P2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Thymidine diphosphate-L-rhamnoseThymidine-5'-diphosphate-L-rhamnose disodium can be isolated from Occhromonas malhamensis[1]. |
| Name | dTDP-β-L-rhamnose |
|---|---|
| Synonym | More Synonyms |
| Description | Thymidine-5'-diphosphate-L-rhamnose disodium can be isolated from Occhromonas malhamensis[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.8±0.1 g/cm3 |
|---|---|
| Molecular Formula | C16H26N2O15P2 |
| Molecular Weight | 548.330 |
| Exact Mass | 548.080811 |
| PSA | 276.15000 |
| LogP | -3.66 |
| Index of Refraction | 1.626 |
| InChIKey | ZOSQFDVXNQFKBY-CGAXJHMRSA-N |
| SMILES | Cc1cn(C2CC(O)C(COP(=O)(O)OP(=O)(O)OC3OC(C)C(O)C(O)C3O)O2)c(=O)[nH]c1=O |
| [(2R,3S,5R)-3-Hydroxy-5-(5-methyl-2,4-dioxo-3,4-dihydro-1(2H)-pyrimidinyl)tetrahydro-2-furanyl]methyl (2R,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyltetrahydro-2H-pyran-2-yl dihydrogen diphosphate (non-preferred name) |
| dTDP-β-L-rhamnose |