L-Asparagine-N-Fmoc,N-beta-trityl-15N2 structure
|
Common Name | L-Asparagine-N-Fmoc,N-beta-trityl-15N2 | ||
|---|---|---|---|---|
| CAS Number | 204633-98-7 | Molecular Weight | N/A | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | N/A | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of L-Asparagine-N-Fmoc,N-beta-trityl-15N2L-Asparagine-N-Fmoc,N-beta-trityl-15N2 is a 15N-labeled Deruxtecan. Deruxtecan is an ADC drug-linker conjugate composed of a derivative of DX-8951 (DXd) and amaleimide-GGFG peptide linker, used for synthesizing DS-8201 and U3-1402. |
| Name | l-asparagine-n-fmoc, n-beta-trityl (15n2) |
|---|
| Description | L-Asparagine-N-Fmoc,N-beta-trityl-15N2 is a 15N-labeled Deruxtecan. Deruxtecan is an ADC drug-linker conjugate composed of a derivative of DX-8951 (DXd) and amaleimide-GGFG peptide linker, used for synthesizing DS-8201 and U3-1402. |
|---|---|
| Related Catalog | |
| In Vitro | Stable heavy isotopes of hydrogen, carbon, and other elements have been incorporated into drug molecules, largely as tracers for quantitation during the drug development process. Deuteration has gained attention because of its potential to affect the pharmacokinetic and metabolic profiles of drugs[75]. |
| References |
| InChIKey | KJYAFJQCGPUXJY-OVARWPCFSA-N |
|---|---|
| SMILES | O=C(CC(NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)O)NC(c1ccccc1)(c1ccccc1)c1ccccc1 |