Boc-L-Ala-OH-3-13C structure
|
Common Name | Boc-L-Ala-OH-3-13C | ||
|---|---|---|---|---|
| CAS Number | 201740-79-6 | Molecular Weight | 190.20 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C713CH15NO4 | Melting Point | 79-83ºC(lit.) | |
| MSDS | USA | Flash Point | N/A | |
Use of Boc-L-Ala-OH-3-13CBoc-L-Ala-OH-3-13C is a 13C-labeled Hypoxanthine. Hypoxanthine, a purine derivative, is a potential free radical generator and could be used as an indicator of hypoxia. |
| Name | N-(tert-Butoxycarbonyl)-L-alanine-3-13C |
|---|---|
| Synonym | More Synonyms |
| Description | Boc-L-Ala-OH-3-13C is a 13C-labeled Hypoxanthine. Hypoxanthine, a purine derivative, is a potential free radical generator and could be used as an indicator of hypoxia. |
|---|---|
| Related Catalog | |
| In Vitro | Stable heavy isotopes of hydrogen, carbon, and other elements have been incorporated into drug molecules, largely as tracers for quantitation during the drug development process. Deuteration has gained attention because of its potential to affect the pharmacokinetic and metabolic profiles of drugs[75]. |
| References |
| Melting Point | 79-83ºC(lit.) |
|---|---|
| Molecular Formula | C713CH15NO4 |
| Molecular Weight | 190.20 |
| Exact Mass | 190.10300 |
| PSA | 75.63000 |
| LogP | 1.37510 |
| InChIKey | QVHJQCGUWFKTSE-BXMHHZGSSA-N |
| SMILES | CC(NC(=O)OC(C)(C)C)C(=O)O |
| RIDADR | NONH for all modes of transport |
|---|---|
| WGK Germany | 3 |
| L-Alanine-3-13C,N-t-Boc derivative |
| MFCD00083885 |
| Boc-Ala-OH-3-13C |